C7H10Cl2O2 — CID 130841191
4-[(1R,3S)-2,2-dichloro-3-hydroxycyclopropyl]butan-2-one (PubChem CID 130841191) has the molecular formula C7H10Cl2O2 and a molecular weight of 197.06 g/mol. Its IUPAC name is 4-[(1R,3S)-2,2-dichloro-3-hydroxycyclopropyl]butan-2-one.
| Compound Name | 4-[(1R,3S)-2,2-dichloro-3-hydroxycyclopropyl]butan-2-one |
|---|---|
| PubChem CID | 130841191 |
| Molecular Formula | C7H10Cl2O2 |
| Molecular Weight | 197.06 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 4-[(1R,3S)-2,2-dichloro-3-hydroxycyclopropyl]butan-2-one |
| SMILES | CC(=O)CC[C@@H]1[C@H](O)C1(Cl)Cl |
| InChI | InChI=1S/C7H10Cl2O2/c1-4(10)2-3-5-6(11)7(5,8)9/h5-6,11H,2-3H2,1H3/t5-,6+/m1/s1 |
| InChIKey | GNFOPSYALXRKJW-RITPCOANSA-N |
| XLogP | 1.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.06 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|