About 4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one
4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one (PubChem CID 132560968) has the molecular formula C17H24O
and a molecular weight of 244.38 g/mol. Its IUPAC name is 4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one.
Molecular Properties
| Compound Name | 4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one |
| PubChem CID | 132560968 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one |
| SMILES | CC[C@@H]1[C@H](CCC(C)=O)[C@@]1(C)Cc1ccccc1 |
| InChI | InChI=1S/C17H24O/c1-4-15-16(11-10-13(2)18)17(15,3)12-14-8-6-5-7-9-14/h5-9,15-16H,4,10-12H2,1-3H3/t15-,16+,17+/m1/s1 |
| InChIKey | ZJQDYOLJBURDOF-IKGGRYGDSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one?
The IUPAC name of 4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one (CID 132560968) is 4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one.
What is the SMILES notation for 4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one?
The canonical SMILES for 4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one is CC[C@@H]1[C@H](CCC(C)=O)[C@@]1(C)Cc1ccccc1.
What is the InChIKey of 4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one?
The InChIKey is ZJQDYOLJBURDOF-IKGGRYGDSA-N. The full InChI is InChI=1S/C17H24O/c1-4-15-16(11-10-13(2)18)17(15,3)12-14-8-6-5-7-9-14/h5-9,15-16H,4,10-12H2,1-3H3/t15-,16+,17+/m1/s1.
What are the key properties of 4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one?
4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one has a molecular weight of 244.38 g/mol, XLogP of 4.26, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S,2S,3R)-2-benzyl-3-ethyl-2-methylcyclopropyl]butan-2-one is sourced from PubChem (CID 132560968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).