C8H13BrO — CID 130763704
1-[(1S,3R)-3-bromo-2,2-dimethylcyclopropyl]propan-2-one (PubChem CID 130763704) has the molecular formula C8H13BrO and a molecular weight of 205.09 g/mol. Its IUPAC name is 1-[(1S,3R)-3-bromo-2,2-dimethylcyclopropyl]propan-2-one.
| Compound Name | 1-[(1S,3R)-3-bromo-2,2-dimethylcyclopropyl]propan-2-one |
|---|---|
| PubChem CID | 130763704 |
| Molecular Formula | C8H13BrO |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 1-[(1S,3R)-3-bromo-2,2-dimethylcyclopropyl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1[C@@H](Br)C1(C)C |
| InChI | InChI=1S/C8H13BrO/c1-5(10)4-6-7(9)8(6,2)3/h6-7H,4H2,1-3H3/t6-,7-/m1/s1 |
| InChIKey | GOEXTKMBVSFYMK-RNFRBKRXSA-N |
| XLogP | 2.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|