C24H34N2O5 — CID 125493457
(3S,4R)-N,N-bis[(2,4-dimethoxyphenyl)methyl]-3-methoxypiperidin-4-amine (PubChem CID 125493457) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is (3S,4R)-N,N-bis[(2,4-dimethoxyphenyl)methyl]-3-methoxypiperidin-4-amine.
| Compound Name | (3S,4R)-N,N-bis[(2,4-dimethoxyphenyl)methyl]-3-methoxypiperidin-4-amine |
|---|---|
| PubChem CID | 125493457 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (3S,4R)-N,N-bis[(2,4-dimethoxyphenyl)methyl]-3-methoxypiperidin-4-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)[C@@H]2CCNC[C@@H]2OC)c(OC)c1 |
| InChI | InChI=1S/C24H34N2O5/c1-27-19-8-6-17(22(12-19)29-3)15-26(21-10-11-25-14-24(21)31-5)16-18-7-9-20(28-2)13-23(18)30-4/h6-9,12-13,21,24-25H,10-11,14-16H2,1-5H3/t21-,24+/m1/s1 |
| InChIKey | STPFLNVUQQPWII-QPPBQGQZSA-N |
| XLogP | 3.10 |
| TPSA | 61.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |