C17H20N2 — CID 125494385
3-(6,7,8,9,10,11-hexahydrocycloocta[b]indol-5-yl)propanenitrile (PubChem CID 125494385) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 3-(6,7,8,9,10,11-hexahydrocycloocta[b]indol-5-yl)propanenitrile.
| Compound Name | 3-(6,7,8,9,10,11-hexahydrocycloocta[b]indol-5-yl)propanenitrile |
|---|---|
| PubChem CID | 125494385 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 3-(6,7,8,9,10,11-hexahydrocycloocta[b]indol-5-yl)propanenitrile |
| SMILES | N#CCCn1c2c(c3ccccc31)CCCCCC2 |
| InChI | InChI=1S/C17H20N2/c18-12-7-13-19-16-10-4-2-1-3-8-14(16)15-9-5-6-11-17(15)19/h5-6,9,11H,1-4,7-8,10,13H2 |
| InChIKey | DTZJTNJTDOFVAM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|