C12H12IN — CID 146323792
9-iodo-1,2,3,4-tetrahydrocarbazole (PubChem CID 146323792) has the molecular formula C12H12IN and a molecular weight of 297.14 g/mol. Its IUPAC name is 9-iodo-1,2,3,4-tetrahydrocarbazole.
| Compound Name | 9-iodo-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 146323792 |
| Molecular Formula | C12H12IN |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 9-iodo-1,2,3,4-tetrahydrocarbazole |
| SMILES | In1c2c(c3ccccc31)CCCC2 |
| InChI | InChI=1S/C12H12IN/c13-14-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1,3,5,7H,2,4,6,8H2 |
| InChIKey | GHDQHBOTNPOISG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|