C18H19N — CID 145313772
9-cyclohexa-2,4-dien-1-yl-1,2,3,4-tetrahydrocarbazole (PubChem CID 145313772) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 9-cyclohexa-2,4-dien-1-yl-1,2,3,4-tetrahydrocarbazole.
| Compound Name | 9-cyclohexa-2,4-dien-1-yl-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 145313772 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 9-cyclohexa-2,4-dien-1-yl-1,2,3,4-tetrahydrocarbazole |
| SMILES | C1=CCC(n2c3c(c4ccccc42)CCCC3)C=C1 |
| InChI | InChI=1S/C18H19N/c1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19/h1-4,6,8,10,12,14H,5,7,9,11,13H2 |
| InChIKey | YUWHJIYISQUFFI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |