C19H16FNO — CID 746851
(2-fluorophenyl)-(1,2,3,4-tetrahydrocarbazol-9-yl)methanone (PubChem CID 746851) has the molecular formula C19H16FNO and a molecular weight of 293.34 g/mol. Its IUPAC name is (2-fluorophenyl)-(1,2,3,4-tetrahydrocarbazol-9-yl)methanone.
| Compound Name | (2-fluorophenyl)-(1,2,3,4-tetrahydrocarbazol-9-yl)methanone |
|---|---|
| PubChem CID | 746851 |
| Molecular Formula | C19H16FNO |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (2-fluorophenyl)-(1,2,3,4-tetrahydrocarbazol-9-yl)methanone |
| SMILES | O=C(c1ccccc1F)n1c2c(c3ccccc31)CCCC2 |
| InChI | InChI=1S/C19H16FNO/c20-16-10-4-1-9-15(16)19(22)21-17-11-5-2-7-13(17)14-8-3-6-12-18(14)21/h1-2,4-5,7,9-11H,3,6,8,12H2 |
| InChIKey | HTHLLAQKKQLKQA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |