methyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate

C16H19NO2 — CID 11334378

IUPACmethyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate
SMILESCOC(=O)[C@@H](C)n1c2c(c3ccccc31)CCCC2
InChIInChI=1S/C16H19NO2/c1-11(16(18)19-2)17-14-9-5-3-7-12(14)13-8-4-6-10-15(13)17/h3,5,7,9,11H,4,6,8,10H2,1-2H3/t11-/m1/s1
InChIKeyYBPXMDZMLARUOA-LLVKDONJSA-N
MW257.33 g/mol
LogP3.25
Rot. Bonds2

About methyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate

methyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate (PubChem CID 11334378) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is methyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate.

Molecular Properties

Compound Namemethyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate
PubChem CID11334378
Molecular FormulaC16H19NO2
Molecular Weight257.33 g/mol
Exact Mass257.14
IUPAC Namemethyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate
SMILESCOC(=O)[C@@H](C)n1c2c(c3ccccc31)CCCC2
InChIInChI=1S/C16H19NO2/c1-11(16(18)19-2)17-14-9-5-3-7-12(14)13-8-4-6-10-15(13)17/h3,5,7,9,11H,4,6,8,10H2,1-2H3/t11-/m1/s1
InChIKeyYBPXMDZMLARUOA-LLVKDONJSA-N
XLogP3.25
TPSA31.23 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.33
LogP ≤ 53.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate?
The IUPAC name of methyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate (CID 11334378) is methyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate.
What is the SMILES notation for methyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate?
The canonical SMILES for methyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate is COC(=O)[C@@H](C)n1c2c(c3ccccc31)CCCC2.
What is the InChIKey of methyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate?
The InChIKey is YBPXMDZMLARUOA-LLVKDONJSA-N. The full InChI is InChI=1S/C16H19NO2/c1-11(16(18)19-2)17-14-9-5-3-7-12(14)13-8-4-6-10-15(13)17/h3,5,7,9,11H,4,6,8,10H2,1-2H3/t11-/m1/s1.
What are the key properties of methyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate?
methyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate has a molecular weight of 257.33 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-(1,2,3,4-tetrahydrocarbazol-9-yl)propanoate is sourced from PubChem (CID 11334378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).