C11H8OS — CID 125495786
7-methylthieno[3,2-b][1]benzofuran (PubChem CID 125495786) has the molecular formula C11H8OS and a molecular weight of 188.25 g/mol. Its IUPAC name is 7-methylthieno[3,2-b][1]benzofuran.
| Compound Name | 7-methylthieno[3,2-b][1]benzofuran |
|---|---|
| PubChem CID | 125495786 |
| Molecular Formula | C11H8OS |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 7-methylthieno[3,2-b][1]benzofuran |
| SMILES | Cc1ccc2oc3ccsc3c2c1 |
| InChI | InChI=1S/C11H8OS/c1-7-2-3-9-8(6-7)11-10(12-9)4-5-13-11/h2-6H,1H3 |
| InChIKey | MBMOZEARFOVFDM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |