C16H12IN — CID 125497022
2-(4-iodophenyl)-8-methylquinoline (PubChem CID 125497022) has the molecular formula C16H12IN and a molecular weight of 345.18 g/mol. Its IUPAC name is 2-(4-iodophenyl)-8-methylquinoline.
| Compound Name | 2-(4-iodophenyl)-8-methylquinoline |
|---|---|
| PubChem CID | 125497022 |
| Molecular Formula | C16H12IN |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 2-(4-iodophenyl)-8-methylquinoline |
| SMILES | Cc1cccc2ccc(-c3ccc(I)cc3)nc12 |
| InChI | InChI=1S/C16H12IN/c1-11-3-2-4-13-7-10-15(18-16(11)13)12-5-8-14(17)9-6-12/h2-10H,1H3 |
| InChIKey | STXXFKTUUIDNLI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|