C16H14NP — CID 140733063
[2-(4-methylphenyl)quinolin-8-yl]phosphane (PubChem CID 140733063) has the molecular formula C16H14NP and a molecular weight of 251.27 g/mol. Its IUPAC name is [2-(4-methylphenyl)quinolin-8-yl]phosphane.
| Compound Name | [2-(4-methylphenyl)quinolin-8-yl]phosphane |
|---|---|
| PubChem CID | 140733063 |
| Molecular Formula | C16H14NP |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | [2-(4-methylphenyl)quinolin-8-yl]phosphane |
| SMILES | Cc1ccc(-c2ccc3cccc(P)c3n2)cc1 |
| InChI | InChI=1S/C16H14NP/c1-11-5-7-12(8-6-11)14-10-9-13-3-2-4-15(18)16(13)17-14/h2-10H,18H2,1H3 |
| InChIKey | VWBNBOYXBCNQAI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|