C13H15ClO — CID 125498764
(4R)-4-(2-chlorophenyl)-2,2-dimethylcyclopentan-1-one (PubChem CID 125498764) has the molecular formula C13H15ClO and a molecular weight of 222.72 g/mol. Its IUPAC name is (4R)-4-(2-chlorophenyl)-2,2-dimethylcyclopentan-1-one.
| Compound Name | (4R)-4-(2-chlorophenyl)-2,2-dimethylcyclopentan-1-one |
|---|---|
| PubChem CID | 125498764 |
| Molecular Formula | C13H15ClO |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (4R)-4-(2-chlorophenyl)-2,2-dimethylcyclopentan-1-one |
| SMILES | CC1(C)C[C@@H](c2ccccc2Cl)CC1=O |
| InChI | InChI=1S/C13H15ClO/c1-13(2)8-9(7-12(13)15)10-5-3-4-6-11(10)14/h3-6,9H,7-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | TVLIODLQQBDSDV-VIFPVBQESA-N |
| XLogP | 3.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |