C22H23Cl2NO — CID 67037436
6,7-bis(2-chlorophenyl)-4-(dimethylamino)bicyclo[2.2.2]octan-2-one (PubChem CID 67037436) has the molecular formula C22H23Cl2NO and a molecular weight of 388.34 g/mol. Its IUPAC name is 6,7-bis(2-chlorophenyl)-4-(dimethylamino)bicyclo[2.2.2]octan-2-one.
| Compound Name | 6,7-bis(2-chlorophenyl)-4-(dimethylamino)bicyclo[2.2.2]octan-2-one |
|---|---|
| PubChem CID | 67037436 |
| Molecular Formula | C22H23Cl2NO |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 6,7-bis(2-chlorophenyl)-4-(dimethylamino)bicyclo[2.2.2]octan-2-one |
| SMILES | CN(C)C12CC(=O)C(C(c3ccccc3Cl)C1)C(c1ccccc1Cl)C2 |
| InChI | InChI=1S/C22H23Cl2NO/c1-25(2)22-11-16(14-7-3-5-9-18(14)23)21(20(26)13-22)17(12-22)15-8-4-6-10-19(15)24/h3-10,16-17,21H,11-13H2,1-2H3 |
| InChIKey | FUBHDKBZAPFVLR-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |