C20H19ClO4 — CID 11024770
(3aR,4S,9bR)-4-(2-chlorophenyl)-7,7-dimethyl-3a,4,5,6,8,9b-hexahydrobenzo[e][2]benzofuran-1,3,9-trione (PubChem CID 11024770) has the molecular formula C20H19ClO4 and a molecular weight of 358.82 g/mol. Its IUPAC name is (3aR,4S,9bR)-4-(2-chlorophenyl)-7,7-dimethyl-3a,4,5,6,8,9b-hexahydrobenzo[e][2]benzofuran-1,3,9-trione.
| Compound Name | (3aR,4S,9bR)-4-(2-chlorophenyl)-7,7-dimethyl-3a,4,5,6,8,9b-hexahydrobenzo[e][2]benzofuran-1,3,9-trione |
|---|---|
| PubChem CID | 11024770 |
| Molecular Formula | C20H19ClO4 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (3aR,4S,9bR)-4-(2-chlorophenyl)-7,7-dimethyl-3a,4,5,6,8,9b-hexahydrobenzo[e][2]benzofuran-1,3,9-trione |
| SMILES | CC1(C)CC(=O)C2=C(C[C@H](c3ccccc3Cl)[C@H]3C(=O)OC(=O)[C@@H]23)C1 |
| InChI | InChI=1S/C20H19ClO4/c1-20(2)8-10-7-12(11-5-3-4-6-13(11)21)16-17(15(10)14(22)9-20)19(24)25-18(16)23/h3-6,12,16-17H,7-9H2,1-2H3/t12-,16-,17+/m1/s1 |
| InChIKey | TWORIOLMSXTJAL-JLZZUVOBSA-N |
| XLogP | 3.83 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|