C17H19ClN2O2 — CID 4017936
4-(2-chlorophenyl)-1,7,7-trimethyl-3,4,6,8-tetrahydroquinazoline-2,5-dione (PubChem CID 4017936) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-1,7,7-trimethyl-3,4,6,8-tetrahydroquinazoline-2,5-dione.
| Compound Name | 4-(2-chlorophenyl)-1,7,7-trimethyl-3,4,6,8-tetrahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 4017936 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 4-(2-chlorophenyl)-1,7,7-trimethyl-3,4,6,8-tetrahydroquinazoline-2,5-dione |
| SMILES | CN1C(=O)NC(c2ccccc2Cl)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C17H19ClN2O2/c1-17(2)8-12-14(13(21)9-17)15(19-16(22)20(12)3)10-6-4-5-7-11(10)18/h4-7,15H,8-9H2,1-3H3,(H,19,22) |
| InChIKey | YAZBUQOJORLGJW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |