C16H21Cl — CID 135198440
(3S)-3-(2-chlorophenyl)-1-propan-2-ylbicyclo[2.2.1]heptane (PubChem CID 135198440) has the molecular formula C16H21Cl and a molecular weight of 248.80 g/mol. Its IUPAC name is (3S)-3-(2-chlorophenyl)-1-propan-2-ylbicyclo[2.2.1]heptane.
| Compound Name | (3S)-3-(2-chlorophenyl)-1-propan-2-ylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 135198440 |
| Molecular Formula | C16H21Cl |
| Molecular Weight | 248.80 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (3S)-3-(2-chlorophenyl)-1-propan-2-ylbicyclo[2.2.1]heptane |
| SMILES | CC(C)C12CCC(C1)[C@@H](c1ccccc1Cl)C2 |
| InChI | InChI=1S/C16H21Cl/c1-11(2)16-8-7-12(9-16)14(10-16)13-5-3-4-6-15(13)17/h3-6,11-12,14H,7-10H2,1-2H3/t12?,14-,16?/m0/s1 |
| InChIKey | NFWYLEMRDGIIFX-UGWHAMFMSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.80 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |