C30H25Cl3O4 — CID 11851121
ethyl (1S,2R,3R,4R)-2,4-bis(2-chlorophenyl)-3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-6-oxocyclohexane-1-carboxylate (PubChem CID 11851121) has the molecular formula C30H25Cl3O4 and a molecular weight of 555.89 g/mol. Its IUPAC name is ethyl (1S,2R,3R,4R)-2,4-bis(2-chlorophenyl)-3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-6-oxocyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,2R,3R,4R)-2,4-bis(2-chlorophenyl)-3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-6-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11851121 |
| Molecular Formula | C30H25Cl3O4 |
| Molecular Weight | 555.89 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | ethyl (1S,2R,3R,4R)-2,4-bis(2-chlorophenyl)-3-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-6-oxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C[C@@H](c2ccccc2Cl)[C@@H](C(=O)/C=C/c2ccccc2Cl)[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C30H25Cl3O4/c1-2-37-30(36)29-26(35)17-21(19-10-4-7-13-23(19)32)27(28(29)20-11-5-8-14-24(20)33)25(34)16-15-18-9-3-6-12-22(18)31/h3-16,21,27-29H,2,17H2,1H3/b16-15+/t21-,27-,28+,29+/m0/s1 |
| InChIKey | LAVFWAIRNVZESW-QTJIYXGZSA-N |
| XLogP | 7.57 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.89 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|