C27H25ClN2O4S — CID 134105057
ethyl (2Z)-2-(benzenesulfonylhydrazinylidene)-6-(2-chlorophenyl)-4-phenylcyclohex-3-ene-1-carboxylate (PubChem CID 134105057) has the molecular formula C27H25ClN2O4S and a molecular weight of 509.03 g/mol. Its IUPAC name is ethyl (2Z)-2-(benzenesulfonylhydrazinylidene)-6-(2-chlorophenyl)-4-phenylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (2Z)-2-(benzenesulfonylhydrazinylidene)-6-(2-chlorophenyl)-4-phenylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134105057 |
| Molecular Formula | C27H25ClN2O4S |
| Molecular Weight | 509.03 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | ethyl (2Z)-2-(benzenesulfonylhydrazinylidene)-6-(2-chlorophenyl)-4-phenylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1/C(=N\NS(=O)(=O)c2ccccc2)C=C(c2ccccc2)CC1c1ccccc1Cl |
| InChI | InChI=1S/C27H25ClN2O4S/c1-2-34-27(31)26-23(22-15-9-10-16-24(22)28)17-20(19-11-5-3-6-12-19)18-25(26)29-30-35(32,33)21-13-7-4-8-14-21/h3-16,18,23,26,30H,2,17H2,1H3/b29-25- |
| InChIKey | RZTFYMFVPVEUCP-GNVQSUKOSA-N |
| XLogP | 5.42 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.03 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|