C18H22BFN2O3 — CID 125499973
(R)-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(3-methylpyrazin-2-yl)methanol (PubChem CID 125499973) has the molecular formula C18H22BFN2O3 and a molecular weight of 344.20 g/mol. Its IUPAC name is (R)-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(3-methylpyrazin-2-yl)methanol.
| Compound Name | (R)-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(3-methylpyrazin-2-yl)methanol |
|---|---|
| PubChem CID | 125499973 |
| Molecular Formula | C18H22BFN2O3 |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (R)-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-(3-methylpyrazin-2-yl)methanol |
| SMILES | Cc1nccnc1[C@H](O)c1ccc(F)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C18H22BFN2O3/c1-11-15(22-9-8-21-11)16(23)12-6-7-14(20)13(10-12)19-24-17(2,3)18(4,5)25-19/h6-10,16,23H,1-5H3/t16-/m1/s1 |
| InChIKey | PRYGATLEQOSYGR-MRXNPFEDSA-N |
| XLogP | 2.31 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|