About 9-benzylxanthen-10-ium perchlorate
9-benzylxanthen-10-ium perchlorate (PubChem CID 12557010) has the molecular formula C20H15ClO5
and a molecular weight of 370.79 g/mol. Its IUPAC name is 9-benzylxanthen-10-ium perchlorate.
Molecular Properties
| Compound Name | 9-benzylxanthen-10-ium perchlorate |
| PubChem CID | 12557010 |
| Molecular Formula | C20H15ClO5 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 9-benzylxanthen-10-ium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(Cc2c3ccccc3[o+]c3ccccc23)cc1 |
| InChI | InChI=1S/C20H15O.ClHO4/c1-2-8-15(9-3-1)14-18-16-10-4-6-12-19(16)21-20-13-7-5-11-17(18)20;2-1(3,4)5/h1-13H,14H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | QURBLEVZFOQDMO-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 103.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-benzylxanthen-10-ium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzylxanthen-10-ium perchlorate?
The IUPAC name of 9-benzylxanthen-10-ium perchlorate (CID 12557010) is 9-benzylxanthen-10-ium perchlorate.
What is the SMILES notation for 9-benzylxanthen-10-ium perchlorate?
The canonical SMILES for 9-benzylxanthen-10-ium perchlorate is [O-][Cl+3]([O-])([O-])[O-].c1ccc(Cc2c3ccccc3[o+]c3ccccc23)cc1.
What is the InChIKey of 9-benzylxanthen-10-ium perchlorate?
The InChIKey is QURBLEVZFOQDMO-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H15O.ClHO4/c1-2-8-15(9-3-1)14-18-16-10-4-6-12-19(16)21-20-13-7-5-11-17(18)20;2-1(3,4)5/h1-13H,14H2;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 9-benzylxanthen-10-ium perchlorate?
9-benzylxanthen-10-ium perchlorate has a molecular weight of 370.79 g/mol, XLogP of 0.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzylxanthen-10-ium perchlorate is sourced from PubChem (CID 12557010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).