C37H27NO2 — CID 132822368
2-(2,2-diphenylethenyl)-1-[(4-nitrophenyl)methyl]-4-phenylnaphthalene (PubChem CID 132822368) has the molecular formula C37H27NO2 and a molecular weight of 517.63 g/mol. Its IUPAC name is 2-(2,2-diphenylethenyl)-1-[(4-nitrophenyl)methyl]-4-phenylnaphthalene.
| Compound Name | 2-(2,2-diphenylethenyl)-1-[(4-nitrophenyl)methyl]-4-phenylnaphthalene |
|---|---|
| PubChem CID | 132822368 |
| Molecular Formula | C37H27NO2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 2-(2,2-diphenylethenyl)-1-[(4-nitrophenyl)methyl]-4-phenylnaphthalene |
| SMILES | O=[N+]([O-])c1ccc(Cc2c(C=C(c3ccccc3)c3ccccc3)cc(-c3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C37H27NO2/c39-38(40)32-22-20-27(21-23-32)24-36-31(25-35(28-12-4-1-5-13-28)29-14-6-2-7-15-29)26-37(30-16-8-3-9-17-30)34-19-11-10-18-33(34)36/h1-23,25-26H,24H2 |
| InChIKey | FIWQPUMZGAASDL-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|