About 9-benzylxanthen-10-ium
9-benzylxanthen-10-ium (PubChem CID 12557009) has the molecular formula C20H15O+
and a molecular weight of 271.34 g/mol. Its IUPAC name is 9-benzylxanthen-10-ium.
Molecular Properties
| Compound Name | 9-benzylxanthen-10-ium |
| PubChem CID | 12557009 |
| Molecular Formula | C20H15O+ |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 9-benzylxanthen-10-ium |
| SMILES | c1ccc(Cc2c3ccccc3[o+]c3ccccc23)cc1 |
| InChI | InChI=1S/C20H15O/c1-2-8-15(9-3-1)14-18-16-10-4-6-12-19(16)21-20-13-7-5-11-17(18)20/h1-13H,14H2/q+1 |
| InChIKey | HRIIGOAVWDRHGQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-benzylxanthen-10-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzylxanthen-10-ium?
The IUPAC name of 9-benzylxanthen-10-ium (CID 12557009) is 9-benzylxanthen-10-ium.
What is the SMILES notation for 9-benzylxanthen-10-ium?
The canonical SMILES for 9-benzylxanthen-10-ium is c1ccc(Cc2c3ccccc3[o+]c3ccccc23)cc1.
What is the InChIKey of 9-benzylxanthen-10-ium?
The InChIKey is HRIIGOAVWDRHGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15O/c1-2-8-15(9-3-1)14-18-16-10-4-6-12-19(16)21-20-13-7-5-11-17(18)20/h1-13H,14H2/q+1.
What are the key properties of 9-benzylxanthen-10-ium?
9-benzylxanthen-10-ium has a molecular weight of 271.34 g/mol, XLogP of 5.46, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzylxanthen-10-ium is sourced from PubChem (CID 12557009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).