About 4-benzyl-2-phenylfuran
4-benzyl-2-phenylfuran (PubChem CID 53341681) has the molecular formula C17H14O
and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-benzyl-2-phenylfuran.
Molecular Properties
| Compound Name | 4-benzyl-2-phenylfuran |
| PubChem CID | 53341681 |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-benzyl-2-phenylfuran |
| SMILES | c1ccc(Cc2coc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C17H14O/c1-3-7-14(8-4-1)11-15-12-17(18-13-15)16-9-5-2-6-10-16/h1-10,12-13H,11H2 |
| InChIKey | WIWPMQFFXJFJAM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-benzyl-2-phenylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-2-phenylfuran?
The IUPAC name of 4-benzyl-2-phenylfuran (CID 53341681) is 4-benzyl-2-phenylfuran.
What is the SMILES notation for 4-benzyl-2-phenylfuran?
The canonical SMILES for 4-benzyl-2-phenylfuran is c1ccc(Cc2coc(-c3ccccc3)c2)cc1.
What is the InChIKey of 4-benzyl-2-phenylfuran?
The InChIKey is WIWPMQFFXJFJAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O/c1-3-7-14(8-4-1)11-15-12-17(18-13-15)16-9-5-2-6-10-16/h1-10,12-13H,11H2.
What are the key properties of 4-benzyl-2-phenylfuran?
4-benzyl-2-phenylfuran has a molecular weight of 234.30 g/mol, XLogP of 4.54, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-2-phenylfuran is sourced from PubChem (CID 53341681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).