C19H21N3OS2 — CID 1256216
4-tert-butyl-N-[(3-cyano-4,5-dimethylthiophen-2-yl)carbamothioyl]benzamide (PubChem CID 1256216) has the molecular formula C19H21N3OS2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 4-tert-butyl-N-[(3-cyano-4,5-dimethylthiophen-2-yl)carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[(3-cyano-4,5-dimethylthiophen-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1256216 |
| Molecular Formula | C19H21N3OS2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-tert-butyl-N-[(3-cyano-4,5-dimethylthiophen-2-yl)carbamothioyl]benzamide |
| SMILES | Cc1sc(NC(=S)NC(=O)c2ccc(C(C)(C)C)cc2)c(C#N)c1C |
| InChI | InChI=1S/C19H21N3OS2/c1-11-12(2)25-17(15(11)10-20)22-18(24)21-16(23)13-6-8-14(9-7-13)19(3,4)5/h6-9H,1-5H3,(H2,21,22,23,24) |
| InChIKey | FSFGDIJWLCOULW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|