C16H12F3NO2S — CID 12562703
5-(4-methoxyphenyl)-2-phenyl-2-(trifluoromethyl)-1,3,4-oxathiazole (PubChem CID 12562703) has the molecular formula C16H12F3NO2S and a molecular weight of 339.34 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-phenyl-2-(trifluoromethyl)-1,3,4-oxathiazole.
| Compound Name | 5-(4-methoxyphenyl)-2-phenyl-2-(trifluoromethyl)-1,3,4-oxathiazole |
|---|---|
| PubChem CID | 12562703 |
| Molecular Formula | C16H12F3NO2S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-phenyl-2-(trifluoromethyl)-1,3,4-oxathiazole |
| SMILES | COc1ccc(C2=NSC(c3ccccc3)(C(F)(F)F)O2)cc1 |
| InChI | InChI=1S/C16H12F3NO2S/c1-21-13-9-7-11(8-10-13)14-20-23-15(22-14,16(17,18)19)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | XVCHNGROJTXIHW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|