C15H14F3N3O — CID 12568859
14-(trifluoromethyl)-9-oxa-2,11,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),10,12(17),13,15-pentaene (PubChem CID 12568859) has the molecular formula C15H14F3N3O and a molecular weight of 309.29 g/mol. Its IUPAC name is 14-(trifluoromethyl)-9-oxa-2,11,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),10,12(17),13,15-pentaene.
| Compound Name | 14-(trifluoromethyl)-9-oxa-2,11,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),10,12(17),13,15-pentaene |
|---|---|
| PubChem CID | 12568859 |
| Molecular Formula | C15H14F3N3O |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 14-(trifluoromethyl)-9-oxa-2,11,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),10,12(17),13,15-pentaene |
| SMILES | FC(F)(F)c1ccc2nc3c(nc2c1)OCC1CCCCN31 |
| InChI | InChI=1S/C15H14F3N3O/c16-15(17,18)9-4-5-11-12(7-9)20-14-13(19-11)21-6-2-1-3-10(21)8-22-14/h4-5,7,10H,1-3,6,8H2 |
| InChIKey | XHGQAUDJIOVKRW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |