C12H14F3N3O2S — CID 146399175
(11R)-5-(trifluoromethyl)-8λ6-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene 8,8-dioxide (PubChem CID 146399175) has the molecular formula C12H14F3N3O2S and a molecular weight of 321.32 g/mol. Its IUPAC name is (11R)-5-(trifluoromethyl)-8λ6-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene 8,8-dioxide.
| Compound Name | (11R)-5-(trifluoromethyl)-8λ6-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene 8,8-dioxide |
|---|---|
| PubChem CID | 146399175 |
| Molecular Formula | C12H14F3N3O2S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | (11R)-5-(trifluoromethyl)-8λ6-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene 8,8-dioxide |
| SMILES | O=S1(=O)NC[C@H]2CCCCN2c2ncc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C12H14F3N3O2S/c13-12(14,15)8-5-10-11(16-6-8)18-4-2-1-3-9(18)7-17-21(10,19)20/h5-6,9,17H,1-4,7H2/t9-/m1/s1 |
| InChIKey | QWKXTGTVYBTHOU-SECBINFHSA-N |
| XLogP | 1.75 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |