C11H16ClN3O3S — CID 159552987
(11S)-5-chloro-13-oxa-8λ6-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene 8,8-dioxide;methane (PubChem CID 159552987) has the molecular formula C11H16ClN3O3S and a molecular weight of 305.79 g/mol. Its IUPAC name is (11S)-5-chloro-13-oxa-8λ6-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene 8,8-dioxide;methane.
| Compound Name | (11S)-5-chloro-13-oxa-8λ6-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene 8,8-dioxide;methane |
|---|---|
| PubChem CID | 159552987 |
| Molecular Formula | C11H16ClN3O3S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (11S)-5-chloro-13-oxa-8λ6-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene 8,8-dioxide;methane |
| SMILES | C.O=S1(=O)NC[C@H]2COCCN2c2ncc(Cl)cc21 |
| InChI | InChI=1S/C10H12ClN3O3S.CH4/c11-7-3-9-10(12-4-7)14-1-2-17-6-8(14)5-13-18(9,15)16;/h3-4,8,13H,1-2,5-6H2;1H4/t8-;/m0./s1 |
| InChIKey | MFQBFNMXDUEVGX-QRPNPIFTSA-N |
| XLogP | 0.87 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |