C13H16ClFN2O2 — CID 129272346
[(4aR,5R)-9-chloro-5-(fluoromethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridin-5-yl]methanol (PubChem CID 129272346) has the molecular formula C13H16ClFN2O2 and a molecular weight of 286.73 g/mol. Its IUPAC name is [(4aR,5R)-9-chloro-5-(fluoromethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridin-5-yl]methanol.
| Compound Name | [(4aR,5R)-9-chloro-5-(fluoromethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridin-5-yl]methanol |
|---|---|
| PubChem CID | 129272346 |
| Molecular Formula | C13H16ClFN2O2 |
| Molecular Weight | 286.73 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | [(4aR,5R)-9-chloro-5-(fluoromethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridin-5-yl]methanol |
| SMILES | OC[C@@]1(CF)Cc2ncc(Cl)cc2N2CCOC[C@H]21 |
| InChI | InChI=1S/C13H16ClFN2O2/c14-9-3-11-10(16-5-9)4-13(7-15,8-18)12-6-19-2-1-17(11)12/h3,5,12,18H,1-2,4,6-8H2/t12-,13-/m0/s1 |
| InChIKey | GYFSZKGTNDLLSZ-STQMWFEESA-N |
| XLogP | 1.44 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.73 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |