C15H18ClFN2O3 — CID 129248639
ethyl 9-chloro-5-(fluoromethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine-5-carboxylate (PubChem CID 129248639) has the molecular formula C15H18ClFN2O3 and a molecular weight of 328.77 g/mol. Its IUPAC name is ethyl 9-chloro-5-(fluoromethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine-5-carboxylate.
| Compound Name | ethyl 9-chloro-5-(fluoromethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine-5-carboxylate |
|---|---|
| PubChem CID | 129248639 |
| Molecular Formula | C15H18ClFN2O3 |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | ethyl 9-chloro-5-(fluoromethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine-5-carboxylate |
| SMILES | CCOC(=O)C1(CF)Cc2ncc(Cl)cc2N2CCOCC21 |
| InChI | InChI=1S/C15H18ClFN2O3/c1-2-22-14(20)15(9-17)6-11-12(5-10(16)7-18-11)19-3-4-21-8-13(15)19/h5,7,13H,2-4,6,8-9H2,1H3 |
| InChIKey | WWRQIZKDDMZLBQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |