C16H21FN2O3 — CID 145333064
ethyl 5-(fluoromethyl)-9-methyl-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine-5-carboxylate (PubChem CID 145333064) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is ethyl 5-(fluoromethyl)-9-methyl-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine-5-carboxylate.
| Compound Name | ethyl 5-(fluoromethyl)-9-methyl-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine-5-carboxylate |
|---|---|
| PubChem CID | 145333064 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | ethyl 5-(fluoromethyl)-9-methyl-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridine-5-carboxylate |
| SMILES | CCOC(=O)C1(CF)Cc2ncc(C)cc2N2CCOCC21 |
| InChI | InChI=1S/C16H21FN2O3/c1-3-22-15(20)16(10-17)7-12-13(6-11(2)8-18-12)19-4-5-21-9-14(16)19/h6,8,14H,3-5,7,9-10H2,1-2H3 |
| InChIKey | PFMDTNDIOBJGGC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |