C13H18N4O2S — CID 167669537
(11S)-5-isocyano-8λ6-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene 8,8-dioxide;methane (PubChem CID 167669537) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is (11S)-5-isocyano-8λ6-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene 8,8-dioxide;methane.
| Compound Name | (11S)-5-isocyano-8λ6-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene 8,8-dioxide;methane |
|---|---|
| PubChem CID | 167669537 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (11S)-5-isocyano-8λ6-thia-1,3,9-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-triene 8,8-dioxide;methane |
| SMILES | C.[C-]#[N+]c1cnc2c(c1)S(=O)(=O)NC[C@@H]1CCCCN21 |
| InChI | InChI=1S/C12H14N4O2S.CH4/c1-13-9-6-11-12(14-7-9)16-5-3-2-4-10(16)8-15-19(11,17)18;/h6-7,10,15H,2-5,8H2;1H4/t10-;/m0./s1 |
| InChIKey | TXBBFJIIJWDOBY-PPHPATTJSA-N |
| XLogP | 1.92 |
| TPSA | 66.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|