C14H14N4O3 — CID 12568862
13-nitro-9-oxa-2,11,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),10,12(17),13,15-pentaene (PubChem CID 12568862) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 13-nitro-9-oxa-2,11,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),10,12(17),13,15-pentaene.
| Compound Name | 13-nitro-9-oxa-2,11,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),10,12(17),13,15-pentaene |
|---|---|
| PubChem CID | 12568862 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 13-nitro-9-oxa-2,11,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),10,12(17),13,15-pentaene |
| SMILES | O=[N+]([O-])c1cccc2nc3c(nc12)OCC1CCCCN31 |
| InChI | InChI=1S/C14H14N4O3/c19-18(20)11-6-3-5-10-12(11)16-14-13(15-10)17-7-2-1-4-9(17)8-21-14/h3,5-6,9H,1-2,4,7-8H2 |
| InChIKey | CUBAUWNQOGIEPW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|