methyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate

C5H9Cl2O5P — CID 12576714

IUPACmethyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate
SMILESCOC(=O)C(Cl)(OC)P(=O)(Cl)OC
InChIInChI=1S/C5H9Cl2O5P/c1-10-4(8)5(6,11-2)13(7,9)12-3/h1-3H3
InChIKeyFEEXFDASUGHYJU-UHFFFAOYSA-N
MW251.00 g/mol
LogP1.78
Rot. Bonds4

About methyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate

methyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate (PubChem CID 12576714) has the molecular formula C5H9Cl2O5P and a molecular weight of 251.00 g/mol. Its IUPAC name is methyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate.

Molecular Properties

Compound Namemethyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate
PubChem CID12576714
Molecular FormulaC5H9Cl2O5P
Molecular Weight251.00 g/mol
Exact Mass249.96
IUPAC Namemethyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate
SMILESCOC(=O)C(Cl)(OC)P(=O)(Cl)OC
InChIInChI=1S/C5H9Cl2O5P/c1-10-4(8)5(6,11-2)13(7,9)12-3/h1-3H3
InChIKeyFEEXFDASUGHYJU-UHFFFAOYSA-N
XLogP1.78
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.00
LogP ≤ 51.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze methyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate?
The IUPAC name of methyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate (CID 12576714) is methyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate.
What is the SMILES notation for methyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate?
The canonical SMILES for methyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate is COC(=O)C(Cl)(OC)P(=O)(Cl)OC.
What is the InChIKey of methyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate?
The InChIKey is FEEXFDASUGHYJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9Cl2O5P/c1-10-4(8)5(6,11-2)13(7,9)12-3/h1-3H3.
What are the key properties of methyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate?
methyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate has a molecular weight of 251.00 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-chloro-2-[chloro(methoxy)phosphoryl]-2-methoxyacetate is sourced from PubChem (CID 12576714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).