C12H16O2 — CID 12580966
spiro[3a,4,7,7a-tetrahydro-2-benzofuran-3,1'-cyclopentane]-1-one (PubChem CID 12580966) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is spiro[3a,4,7,7a-tetrahydro-2-benzofuran-3,1'-cyclopentane]-1-one.
| Compound Name | spiro[3a,4,7,7a-tetrahydro-2-benzofuran-3,1'-cyclopentane]-1-one |
|---|---|
| PubChem CID | 12580966 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | spiro[3a,4,7,7a-tetrahydro-2-benzofuran-3,1'-cyclopentane]-1-one |
| SMILES | O=C1OC2(CCCC2)C2CC=CCC12 |
| InChI | InChI=1S/C12H16O2/c13-11-9-5-1-2-6-10(9)12(14-11)7-3-4-8-12/h1-2,9-10H,3-8H2 |
| InChIKey | BCKGMDAYEQVYFL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|