About 6-bromo-N,N-diethylhexan-1-amine
6-bromo-N,N-diethylhexan-1-amine (PubChem CID 12583379) has the molecular formula C10H22BrN
and a molecular weight of 236.20 g/mol. Its IUPAC name is 6-bromo-N,N-diethylhexan-1-amine.
Molecular Properties
| Compound Name | 6-bromo-N,N-diethylhexan-1-amine |
| PubChem CID | 12583379 |
| Molecular Formula | C10H22BrN |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 6-bromo-N,N-diethylhexan-1-amine |
| SMILES | CCN(CC)CCCCCCBr |
| InChI | InChI=1S/C10H22BrN/c1-3-12(4-2)10-8-6-5-7-9-11/h3-10H2,1-2H3 |
| InChIKey | GGSFATGQTSRBQK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-N,N-diethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N,N-diethylhexan-1-amine?
The IUPAC name of 6-bromo-N,N-diethylhexan-1-amine (CID 12583379) is 6-bromo-N,N-diethylhexan-1-amine.
What is the SMILES notation for 6-bromo-N,N-diethylhexan-1-amine?
The canonical SMILES for 6-bromo-N,N-diethylhexan-1-amine is CCN(CC)CCCCCCBr.
What is the InChIKey of 6-bromo-N,N-diethylhexan-1-amine?
The InChIKey is GGSFATGQTSRBQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22BrN/c1-3-12(4-2)10-8-6-5-7-9-11/h3-10H2,1-2H3.
What are the key properties of 6-bromo-N,N-diethylhexan-1-amine?
6-bromo-N,N-diethylhexan-1-amine has a molecular weight of 236.20 g/mol, XLogP of 3.28, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N,N-diethylhexan-1-amine is sourced from PubChem (CID 12583379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).