C6H2F9NO2S — CID 12590821
2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetonitrile (PubChem CID 12590821) has the molecular formula C6H2F9NO2S and a molecular weight of 323.14 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetonitrile.
| Compound Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetonitrile |
|---|---|
| PubChem CID | 12590821 |
| Molecular Formula | C6H2F9NO2S |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)acetonitrile |
| SMILES | N#CCS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H2F9NO2S/c7-3(8,5(11,12)13)4(9,10)6(14,15)19(17,18)2-1-16/h2H2 |
| InChIKey | PTKXFXTXWOXNDF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|