C6H8F3NO2S — CID 57788363
2-(3,3,3-Trifluoropropylsulfonyl)propionitrile (PubChem CID 57788363) has the molecular formula C6H8F3NO2S and a molecular weight of 215.20 g/mol. Its IUPAC name is 2-(3,3,3-trifluoropropylsulfonyl)propanenitrile.
| Compound Name | 2-(3,3,3-Trifluoropropylsulfonyl)propionitrile |
|---|---|
| PubChem CID | 57788363 |
| Molecular Formula | C6H8F3NO2S |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 2-(3,3,3-trifluoropropylsulfonyl)propanenitrile |
| SMILES | CC(C#N)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C6H8F3NO2S/c1-5(4-10)13(11,12)3-2-6(7,8)9/h5H,2-3H2,1H3 |
| InChIKey | ZSFASHGQGYBEKH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 66.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | 305 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |