C9H9F8NO2S2 — CID 52950736
2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanenitrile (PubChem CID 52950736) has the molecular formula C9H9F8NO2S2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanenitrile.
| Compound Name | 2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanenitrile |
|---|---|
| PubChem CID | 52950736 |
| Molecular Formula | C9H9F8NO2S2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 2-(3,3,4,4,4-pentafluorobutylsulfonyl)-4-(trifluoromethylsulfanyl)butanenitrile |
| SMILES | N#CC(CCSC(F)(F)F)S(=O)(=O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F8NO2S2/c10-7(11,8(12,13)14)2-4-22(19,20)6(5-18)1-3-21-9(15,16)17/h6H,1-4H2 |
| InChIKey | MDJSCDOSOAFTMW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|