C8H12O2 — CID 12591215
(1S,2S,5S)-9-oxabicyclo[3.3.1]non-6-en-2-ol (PubChem CID 12591215) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (1S,2S,5S)-9-oxabicyclo[3.3.1]non-6-en-2-ol.
| Compound Name | (1S,2S,5S)-9-oxabicyclo[3.3.1]non-6-en-2-ol |
|---|---|
| PubChem CID | 12591215 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (1S,2S,5S)-9-oxabicyclo[3.3.1]non-6-en-2-ol |
| SMILES | O[C@H]1CC[C@H]2C=CC[C@@H]1O2 |
| InChI | InChI=1S/C8H12O2/c9-7-5-4-6-2-1-3-8(7)10-6/h1-2,6-9H,3-5H2/t6-,7+,8+/m1/s1 |
| InChIKey | GVFZEYUGMDHNHE-CSMHCCOUSA-N |
| XLogP | 0.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|