C11H12N4 — CID 12592831
N,N-dimethyl-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 12592831) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is N,N-dimethyl-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | N,N-dimethyl-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 12592831 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | N,N-dimethyl-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | CN(C)c1nncc(-c2ccccc2)n1 |
| InChI | InChI=1S/C11H12N4/c1-15(2)11-13-10(8-12-14-11)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | AFYMVRMZTWWBRM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |