N-tert-butyl-2-chloroethanimidoyl chloride

C6H11Cl2N — CID 12594976

IUPACN-tert-butyl-2-chloroethanimidoyl chloride
SMILESCC(C)(C)/N=C(\Cl)CCl
InChIInChI=1S/C6H11Cl2N/c1-6(2,3)9-5(8)4-7/h4H2,1-3H3/b9-5-
InChIKeyKHRNENJJWIMGLJ-UITAMQMPSA-N
MW168.07 g/mol
LogP2.66
Rot. Bonds1

About N-tert-butyl-2-chloroethanimidoyl chloride

N-tert-butyl-2-chloroethanimidoyl chloride (PubChem CID 12594976) has the molecular formula C6H11Cl2N and a molecular weight of 168.07 g/mol. Its IUPAC name is N-tert-butyl-2-chloroethanimidoyl chloride.

Molecular Properties

Compound NameN-tert-butyl-2-chloroethanimidoyl chloride
PubChem CID12594976
Molecular FormulaC6H11Cl2N
Molecular Weight168.07 g/mol
Exact Mass167.03
IUPAC NameN-tert-butyl-2-chloroethanimidoyl chloride
SMILESCC(C)(C)/N=C(\Cl)CCl
InChIInChI=1S/C6H11Cl2N/c1-6(2,3)9-5(8)4-7/h4H2,1-3H3/b9-5-
InChIKeyKHRNENJJWIMGLJ-UITAMQMPSA-N
XLogP2.66
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.07
LogP ≤ 52.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze N-tert-butyl-2-chloroethanimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-tert-butyl-2-chloroethanimidoyl chloride?
The IUPAC name of N-tert-butyl-2-chloroethanimidoyl chloride (CID 12594976) is N-tert-butyl-2-chloroethanimidoyl chloride.
What is the SMILES notation for N-tert-butyl-2-chloroethanimidoyl chloride?
The canonical SMILES for N-tert-butyl-2-chloroethanimidoyl chloride is CC(C)(C)/N=C(\Cl)CCl.
What is the InChIKey of N-tert-butyl-2-chloroethanimidoyl chloride?
The InChIKey is KHRNENJJWIMGLJ-UITAMQMPSA-N. The full InChI is InChI=1S/C6H11Cl2N/c1-6(2,3)9-5(8)4-7/h4H2,1-3H3/b9-5-.
What are the key properties of N-tert-butyl-2-chloroethanimidoyl chloride?
N-tert-butyl-2-chloroethanimidoyl chloride has a molecular weight of 168.07 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-chloroethanimidoyl chloride is sourced from PubChem (CID 12594976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).