About 3-(methoxymethyl)-6-methylidenecyclohexa-1,4-diene
3-(methoxymethyl)-6-methylidenecyclohexa-1,4-diene (PubChem CID 12596346) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is 3-(methoxymethyl)-6-methylidenecyclohexa-1,4-diene.
Analyze 3-(methoxymethyl)-6-methylidenecyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethyl)-6-methylidenecyclohexa-1,4-diene?
The IUPAC name of 3-(methoxymethyl)-6-methylidenecyclohexa-1,4-diene (CID 12596346) is 3-(methoxymethyl)-6-methylidenecyclohexa-1,4-diene.
What is the SMILES notation for 3-(methoxymethyl)-6-methylidenecyclohexa-1,4-diene?
The canonical SMILES for 3-(methoxymethyl)-6-methylidenecyclohexa-1,4-diene is C=C1C=CC(COC)C=C1.
What is the InChIKey of 3-(methoxymethyl)-6-methylidenecyclohexa-1,4-diene?
The InChIKey is IMADEVKBUFDOFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O/c1-8-3-5-9(6-4-8)7-10-2/h3-6,9H,1,7H2,2H3.
What are the key properties of 3-(methoxymethyl)-6-methylidenecyclohexa-1,4-diene?
3-(methoxymethyl)-6-methylidenecyclohexa-1,4-diene has a molecular weight of 136.19 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethyl)-6-methylidenecyclohexa-1,4-diene is sourced from PubChem (CID 12596346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).