C11H14O — CID 86227164
5-(1-ethoxyethenyl)-6-methylidenecyclohexa-1,3-diene (PubChem CID 86227164) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is 5-(1-ethoxyethenyl)-6-methylidenecyclohexa-1,3-diene.
| Compound Name | 5-(1-ethoxyethenyl)-6-methylidenecyclohexa-1,3-diene |
|---|---|
| PubChem CID | 86227164 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 5-(1-ethoxyethenyl)-6-methylidenecyclohexa-1,3-diene |
| SMILES | C=C1C=CC=CC1C(=C)OCC |
| InChI | InChI=1S/C11H14O/c1-4-12-10(3)11-8-6-5-7-9(11)2/h5-8,11H,2-4H2,1H3 |
| InChIKey | CJZDSXCCMXALEE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|