C11H17FO — CID 145318056
(2E,4Z,6E)-3-fluoro-9-methoxy-4-methylnona-2,4,6-triene (PubChem CID 145318056) has the molecular formula C11H17FO and a molecular weight of 184.25 g/mol. Its IUPAC name is (2E,4Z,6E)-3-fluoro-9-methoxy-4-methylnona-2,4,6-triene.
| Compound Name | (2E,4Z,6E)-3-fluoro-9-methoxy-4-methylnona-2,4,6-triene |
|---|---|
| PubChem CID | 145318056 |
| Molecular Formula | C11H17FO |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (2E,4Z,6E)-3-fluoro-9-methoxy-4-methylnona-2,4,6-triene |
| SMILES | C/C=C(F)\C(C)=C/C=C/CCOC |
| InChI | InChI=1S/C11H17FO/c1-4-11(12)10(2)8-6-5-7-9-13-3/h4-6,8H,7,9H2,1-3H3/b6-5+,10-8-,11-4+ |
| InChIKey | VRWPABUYDCOUJI-ABFVCOBNSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|