C37H28N4O7S3 — CID 126001664
ethyl (2Z,5R)-5-(4-methylsulfanylphenyl)-2-[[1-(3-nitrophenyl)sulfonylindol-3-yl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126001664) has the molecular formula C37H28N4O7S3 and a molecular weight of 736.85 g/mol. Its IUPAC name is ethyl (2Z,5R)-5-(4-methylsulfanylphenyl)-2-[[1-(3-nitrophenyl)sulfonylindol-3-yl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5R)-5-(4-methylsulfanylphenyl)-2-[[1-(3-nitrophenyl)sulfonylindol-3-yl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126001664 |
| Molecular Formula | C37H28N4O7S3 |
| Molecular Weight | 736.85 g/mol |
| Exact Mass | 736.11 |
| IUPAC Name | ethyl (2Z,5R)-5-(4-methylsulfanylphenyl)-2-[[1-(3-nitrophenyl)sulfonylindol-3-yl]methylidene]-3-oxo-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=c2s/c(=C\c3cn(S(=O)(=O)c4cccc([N+](=O)[O-])c4)c4ccccc34)c(=O)n2[C@@H]1c1ccc(SC)cc1 |
| InChI | InChI=1S/C37H28N4O7S3/c1-3-48-36(43)32-33(23-10-5-4-6-11-23)38-37-40(34(32)24-16-18-27(49-2)19-17-24)35(42)31(50-37)20-25-22-39(30-15-8-7-14-29(25)30)51(46,47)28-13-9-12-26(21-28)41(44)45/h4-22,34H,3H2,1-2H3/b31-20-/t34-/m1/s1 |
| InChIKey | KZJUUBCTPJRONI-JBVGNYNVSA-N |
| XLogP | 5.76 |
| TPSA | 142.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.85 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|