C18H16IN3O2 — CID 126002547
3-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]benzamide (PubChem CID 126002547) has the molecular formula C18H16IN3O2 and a molecular weight of 433.25 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]benzamide.
| Compound Name | 3-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 126002547 |
| Molecular Formula | C18H16IN3O2 |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 3-(2,5-dimethylpyrrol-1-yl)-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]benzamide |
| SMILES | Cc1ccc(C)n1-c1cccc(C(=O)N/N=C\c2ccc(I)o2)c1 |
| InChI | InChI=1S/C18H16IN3O2/c1-12-6-7-13(2)22(12)15-5-3-4-14(10-15)18(23)21-20-11-16-8-9-17(19)24-16/h3-11H,1-2H3,(H,21,23)/b20-11- |
| InChIKey | CAZBHDGCULCXLF-JAIQZWGSSA-N |
| XLogP | 4.06 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|