C17H12BrN3O2S — CID 126003143
N-[(Z)-(4-bromo-5-phenylsulfanylfuran-2-yl)methylideneamino]pyridine-3-carboxamide (PubChem CID 126003143) has the molecular formula C17H12BrN3O2S and a molecular weight of 402.27 g/mol. Its IUPAC name is N-[(Z)-(4-bromo-5-phenylsulfanylfuran-2-yl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(Z)-(4-bromo-5-phenylsulfanylfuran-2-yl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126003143 |
| Molecular Formula | C17H12BrN3O2S |
| Molecular Weight | 402.27 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | N-[(Z)-(4-bromo-5-phenylsulfanylfuran-2-yl)methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Br)c(Sc2ccccc2)o1)c1cccnc1 |
| InChI | InChI=1S/C17H12BrN3O2S/c18-15-9-13(23-17(15)24-14-6-2-1-3-7-14)11-20-21-16(22)12-5-4-8-19-10-12/h1-11H,(H,21,22)/b20-11- |
| InChIKey | INWIJTWTJYBLJG-JAIQZWGSSA-N |
| XLogP | 4.35 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|