C17H11BrClN3O2S — CID 4669124
N-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]pyridine-2-carboxamide (PubChem CID 4669124) has the molecular formula C17H11BrClN3O2S and a molecular weight of 436.72 g/mol. Its IUPAC name is N-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]pyridine-2-carboxamide.
| Compound Name | N-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 4669124 |
| Molecular Formula | C17H11BrClN3O2S |
| Molecular Weight | 436.72 g/mol |
| Exact Mass | 434.94 |
| IUPAC Name | N-[[4-bromo-5-(4-chlorophenyl)sulfanylfuran-2-yl]methylideneamino]pyridine-2-carboxamide |
| SMILES | O=C(NN=Cc1cc(Br)c(Sc2ccc(Cl)cc2)o1)c1ccccn1 |
| InChI | InChI=1S/C17H11BrClN3O2S/c18-14-9-12(10-21-22-16(23)15-3-1-2-8-20-15)24-17(14)25-13-6-4-11(19)5-7-13/h1-10H,(H,22,23) |
| InChIKey | AIOKWLHOIPMCIJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.72 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|